C26H33N3O2 — CID 69187688
1-[[5-(4-cyanophenyl)-2-methoxyphenyl]methyl]-4-(diethylamino)cyclohexane-1-carboxamide (PubChem CID 69187688) has the molecular formula C26H33N3O2 and a molecular weight of 419.57 g/mol. Its IUPAC name is 1-[[5-(4-cyanophenyl)-2-methoxyphenyl]methyl]-4-(diethylamino)cyclohexane-1-carboxamide.
| Compound Name | 1-[[5-(4-cyanophenyl)-2-methoxyphenyl]methyl]-4-(diethylamino)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 69187688 |
| Molecular Formula | C26H33N3O2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.26 |
| IUPAC Name | 1-[[5-(4-cyanophenyl)-2-methoxyphenyl]methyl]-4-(diethylamino)cyclohexane-1-carboxamide |
| SMILES | CCN(CC)C1CCC(Cc2cc(-c3ccc(C#N)cc3)ccc2OC)(C(N)=O)CC1 |
| InChI | InChI=1S/C26H33N3O2/c1-4-29(5-2)23-12-14-26(15-13-23,25(28)30)17-22-16-21(10-11-24(22)31-3)20-8-6-19(18-27)7-9-20/h6-11,16,23H,4-5,12-15,17H2,1-3H3,(H2,28,30) |
| InChIKey | HXEXDTBFLGUYPX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 79.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |