C6H6N4O — CID 69188252
5-(2-methylfuran-3-yl)-2H-tetrazole (PubChem CID 69188252) has the molecular formula C6H6N4O and a molecular weight of 150.14 g/mol. Its IUPAC name is 5-(2-methylfuran-3-yl)-2H-tetrazole.
| Compound Name | 5-(2-methylfuran-3-yl)-2H-tetrazole |
|---|---|
| PubChem CID | 69188252 |
| Molecular Formula | C6H6N4O |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 5-(2-methylfuran-3-yl)-2H-tetrazole |
| SMILES | Cc1occc1-c1nn[nH]n1 |
| InChI | InChI=1S/C6H6N4O/c1-4-5(2-3-11-4)6-7-9-10-8-6/h2-3H,1H3,(H,7,8,9,10) |
| InChIKey | BYJZUGUVFUZFSY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |