C25H27N7 — CID 69189901
8-[4-(4-ethylpiperazin-1-yl)but-1-ynyl]-2-imidazol-1-ylbenzo[f][2,7]naphthyridin-4-amine (PubChem CID 69189901) has the molecular formula C25H27N7 and a molecular weight of 425.54 g/mol. Its IUPAC name is 8-[4-(4-ethylpiperazin-1-yl)but-1-ynyl]-2-imidazol-1-ylbenzo[f][2,7]naphthyridin-4-amine.
| Compound Name | 8-[4-(4-ethylpiperazin-1-yl)but-1-ynyl]-2-imidazol-1-ylbenzo[f][2,7]naphthyridin-4-amine |
|---|---|
| PubChem CID | 69189901 |
| Molecular Formula | C25H27N7 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 8-[4-(4-ethylpiperazin-1-yl)but-1-ynyl]-2-imidazol-1-ylbenzo[f][2,7]naphthyridin-4-amine |
| SMILES | CCN1CCN(CCC#Cc2ccc3c(c2)ncc2c(N)nc(-n4ccnc4)cc23)CC1 |
| InChI | InChI=1S/C25H27N7/c1-2-30-11-13-31(14-12-30)9-4-3-5-19-6-7-20-21-16-24(32-10-8-27-18-32)29-25(26)22(21)17-28-23(20)15-19/h6-8,10,15-18H,2,4,9,11-14H2,1H3,(H2,26,29) |
| InChIKey | YRSZREJNLKNKOZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|