C26H26F3N5O — CID 69190773
4-(butylamino)-N-[2-methyl-5-[3-(trifluoromethyl)anilino]phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide (PubChem CID 69190773) has the molecular formula C26H26F3N5O and a molecular weight of 481.52 g/mol. Its IUPAC name is 4-(butylamino)-N-[2-methyl-5-[3-(trifluoromethyl)anilino]phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide.
| Compound Name | 4-(butylamino)-N-[2-methyl-5-[3-(trifluoromethyl)anilino]phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 69190773 |
| Molecular Formula | C26H26F3N5O |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 4-(butylamino)-N-[2-methyl-5-[3-(trifluoromethyl)anilino]phenyl]-1H-pyrrolo[2,3-b]pyridine-5-carboxamide |
| SMILES | CCCCNc1c(C(=O)Nc2cc(Nc3cccc(C(F)(F)F)c3)ccc2C)cnc2[nH]ccc12 |
| InChI | InChI=1S/C26H26F3N5O/c1-3-4-11-30-23-20-10-12-31-24(20)32-15-21(23)25(35)34-22-14-19(9-8-16(22)2)33-18-7-5-6-17(13-18)26(27,28)29/h5-10,12-15,33H,3-4,11H2,1-2H3,(H,34,35)(H2,30,31,32) |
| InChIKey | RONPSYJKVKFUGL-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|