C23H16F3N5O5 — CID 69191333
2-ethyl-7-[3-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid (PubChem CID 69191333) has the molecular formula C23H16F3N5O5 and a molecular weight of 499.41 g/mol. Its IUPAC name is 2-ethyl-7-[3-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid.
| Compound Name | 2-ethyl-7-[3-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
|---|---|
| PubChem CID | 69191333 |
| Molecular Formula | C23H16F3N5O5 |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2-ethyl-7-[3-[[3-nitro-5-(trifluoromethyl)benzoyl]amino]phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| SMILES | CCc1nn2c(-c3cccc(NC(=O)c4cc([N+](=O)[O-])cc(C(F)(F)F)c4)c3)ccnc2c1C(=O)O |
| InChI | InChI=1S/C23H16F3N5O5/c1-2-17-19(22(33)34)20-27-7-6-18(30(20)29-17)12-4-3-5-15(9-12)28-21(32)13-8-14(23(24,25)26)11-16(10-13)31(35)36/h3-11H,2H2,1H3,(H,28,32)(H,33,34) |
| InChIKey | IDRRVPHIZLWPOQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 139.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|