C11H16N5S2+ — CID 6919582
3-methyl-7-(4-methylpiperazin-4-ium-1-yl)-[1,3]thiazolo[4,5-d]pyrimidine-2-thione (PubChem CID 6919582) has the molecular formula C11H16N5S2+ and a molecular weight of 282.42 g/mol. Its IUPAC name is 3-methyl-7-(4-methylpiperazin-4-ium-1-yl)-[1,3]thiazolo[4,5-d]pyrimidine-2-thione.
| Compound Name | 3-methyl-7-(4-methylpiperazin-4-ium-1-yl)-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 6919582 |
| Molecular Formula | C11H16N5S2+ |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 3-methyl-7-(4-methylpiperazin-4-ium-1-yl)-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
| SMILES | Cn1c(=S)sc2c(N3CC[NH+](C)CC3)ncnc21 |
| InChI | InChI=1S/C11H15N5S2/c1-14-3-5-16(6-4-14)10-8-9(12-7-13-10)15(2)11(17)18-8/h7H,3-6H2,1-2H3/p+1 |
| InChIKey | LWRQZQHCUGQAJF-UHFFFAOYSA-O |
| XLogP | 0.09 |
| TPSA | 38.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|