C15H18BrNO — CID 69196257
[2-[(4-bromophenyl)methyl]pyrrolidin-2-yl]-cyclopropylmethanone (PubChem CID 69196257) has the molecular formula C15H18BrNO and a molecular weight of 308.22 g/mol. Its IUPAC name is [2-[(4-bromophenyl)methyl]pyrrolidin-2-yl]-cyclopropylmethanone.
| Compound Name | [2-[(4-bromophenyl)methyl]pyrrolidin-2-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 69196257 |
| Molecular Formula | C15H18BrNO |
| Molecular Weight | 308.22 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | [2-[(4-bromophenyl)methyl]pyrrolidin-2-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)C1(Cc2ccc(Br)cc2)CCCN1 |
| InChI | InChI=1S/C15H18BrNO/c16-13-6-2-11(3-7-13)10-15(8-1-9-17-15)14(18)12-4-5-12/h2-3,6-7,12,17H,1,4-5,8-10H2 |
| InChIKey | MMEGMJSQKKLTOR-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |