C21H35NO2 — CID 170595415
cyclopropyl-[2-(phenylmethoxymethyl)pyrrolidin-2-yl]methanone;ethane;propane (PubChem CID 170595415) has the molecular formula C21H35NO2 and a molecular weight of 333.52 g/mol. Its IUPAC name is cyclopropyl-[2-(phenylmethoxymethyl)pyrrolidin-2-yl]methanone;ethane;propane.
| Compound Name | cyclopropyl-[2-(phenylmethoxymethyl)pyrrolidin-2-yl]methanone;ethane;propane |
|---|---|
| PubChem CID | 170595415 |
| Molecular Formula | C21H35NO2 |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.27 |
| IUPAC Name | cyclopropyl-[2-(phenylmethoxymethyl)pyrrolidin-2-yl]methanone;ethane;propane |
| SMILES | CC.CCC.O=C(C1CC1)C1(COCc2ccccc2)CCCN1 |
| InChI | InChI=1S/C16H21NO2.C3H8.C2H6/c18-15(14-7-8-14)16(9-4-10-17-16)12-19-11-13-5-2-1-3-6-13;1-3-2;1-2/h1-3,5-6,14,17H,4,7-12H2;3H2,1-2H3;1-2H3 |
| InChIKey | HNOYBFTYEKIWRP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |