C10H14N2O2S — CID 69196415
3-(dimethylamino)-1-(2-methoxy-4-methyl-1,3-thiazol-5-yl)prop-2-en-1-one (PubChem CID 69196415) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is 3-(dimethylamino)-1-(2-methoxy-4-methyl-1,3-thiazol-5-yl)prop-2-en-1-one.
| Compound Name | 3-(dimethylamino)-1-(2-methoxy-4-methyl-1,3-thiazol-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 69196415 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 3-(dimethylamino)-1-(2-methoxy-4-methyl-1,3-thiazol-5-yl)prop-2-en-1-one |
| SMILES | COc1nc(C)c(C(=O)C=CN(C)C)s1 |
| InChI | InChI=1S/C10H14N2O2S/c1-7-9(15-10(11-7)14-4)8(13)5-6-12(2)3/h5-6H,1-4H3 |
| InChIKey | YDSOCEFRRSWZFI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|