C16H24N3O3S+ — CID 6919770
diethyl-[2-[(2R)-3-[(2-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]ethyl]azanium (PubChem CID 6919770) has the molecular formula C16H24N3O3S+ and a molecular weight of 338.45 g/mol. Its IUPAC name is diethyl-[2-[(2R)-3-[(2-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[(2R)-3-[(2-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]ethyl]azanium |
|---|---|
| PubChem CID | 6919770 |
| Molecular Formula | C16H24N3O3S+ |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | diethyl-[2-[(2R)-3-[(2-nitrophenyl)methyl]-4-oxo-1,3-thiazolidin-2-yl]ethyl]azanium |
| SMILES | CC[NH+](CC)CC[C@H]1SCC(=O)N1Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H23N3O3S/c1-3-17(4-2)10-9-16-18(15(20)12-23-16)11-13-7-5-6-8-14(13)19(21)22/h5-8,16H,3-4,9-12H2,1-2H3/p+1/t16-/m1/s1 |
| InChIKey | FNNIVQCCQKTSCF-MRXNPFEDSA-O |
| XLogP | 1.31 |
| TPSA | 67.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|