C16H17N3O2 — CID 115318541
3-methyl-4-[(2-nitrophenyl)methyl]-2,3-dihydro-1H-quinoxaline (PubChem CID 115318541) has the molecular formula C16H17N3O2 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-methyl-4-[(2-nitrophenyl)methyl]-2,3-dihydro-1H-quinoxaline.
| Compound Name | 3-methyl-4-[(2-nitrophenyl)methyl]-2,3-dihydro-1H-quinoxaline |
|---|---|
| PubChem CID | 115318541 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 3-methyl-4-[(2-nitrophenyl)methyl]-2,3-dihydro-1H-quinoxaline |
| SMILES | CC1CNc2ccccc2N1Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N3O2/c1-12-10-17-14-7-3-5-9-16(14)18(12)11-13-6-2-4-8-15(13)19(20)21/h2-9,12,17H,10-11H2,1H3 |
| InChIKey | LHRKEVMPNNGTME-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|