About (2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid
(2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 69198705) has the molecular formula C9H10F3NO5
and a molecular weight of 269.18 g/mol. Its IUPAC name is (2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid.
Analyze (2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid?
The IUPAC name of (2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid (CID 69198705) is (2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid.
What is the SMILES notation for (2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid?
The canonical SMILES for (2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid is C[C@@](N)(C(=O)O)c1ccoc1.O=C(O)C(F)(F)F.
What is the InChIKey of (2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid?
The InChIKey is FIZUAYIRVIJDNN-FJXQXJEOSA-N. The full InChI is InChI=1S/C7H9NO3.C2HF3O2/c1-7(8,6(9)10)5-2-3-11-4-5;3-2(4,5)1(6)7/h2-4H,8H2,1H3,(H,9,10);(H,6,7)/t7-;/m0./s1.
What are the key properties of (2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid?
(2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid has a molecular weight of 269.18 g/mol, XLogP of 1.17, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-2-(furan-3-yl)propanoic acid;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 69198705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).