(2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid

C9H10F3NO5 — CID 69433043

IUPAC(2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid
SMILESC[C@H](C(=O)O)c1ccoc1N.O=C(O)C(F)(F)F
InChIInChI=1S/C7H9NO3.C2HF3O2/c1-4(7(9)10)5-2-3-11-6(5)8;3-2(4,5)1(6)7/h2-4H,8H2,1H3,(H,9,10);(H,6,7)/t4-;/m0./s1
InChIKeyVCWFROYQYUYGPE-WCCKRBBISA-N
MW269.18 g/mol
LogP1.68
Rot. Bonds2

About (2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid

(2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 69433043) has the molecular formula C9H10F3NO5 and a molecular weight of 269.18 g/mol. Its IUPAC name is (2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name(2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid
PubChem CID69433043
Molecular FormulaC9H10F3NO5
Molecular Weight269.18 g/mol
Exact Mass269.05
IUPAC Name(2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid
SMILESC[C@H](C(=O)O)c1ccoc1N.O=C(O)C(F)(F)F
InChIInChI=1S/C7H9NO3.C2HF3O2/c1-4(7(9)10)5-2-3-11-6(5)8;3-2(4,5)1(6)7/h2-4H,8H2,1H3,(H,9,10);(H,6,7)/t4-;/m0./s1
InChIKeyVCWFROYQYUYGPE-WCCKRBBISA-N
XLogP1.68
TPSA113.76 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.18
LogP ≤ 51.68
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Analyze (2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid?
The IUPAC name of (2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid (CID 69433043) is (2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid.
What is the SMILES notation for (2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid?
The canonical SMILES for (2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid is C[C@H](C(=O)O)c1ccoc1N.O=C(O)C(F)(F)F.
What is the InChIKey of (2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid?
The InChIKey is VCWFROYQYUYGPE-WCCKRBBISA-N. The full InChI is InChI=1S/C7H9NO3.C2HF3O2/c1-4(7(9)10)5-2-3-11-6(5)8;3-2(4,5)1(6)7/h2-4H,8H2,1H3,(H,9,10);(H,6,7)/t4-;/m0./s1.
What are the key properties of (2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid?
(2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid has a molecular weight of 269.18 g/mol, XLogP of 1.68, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-(2-aminofuran-3-yl)propanoic acid;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 69433043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).