C26H26F3IN2O4 — CID 69198745
2-iodo-1-[[4-[2-[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]piperidine-2-carboxylic acid (PubChem CID 69198745) has the molecular formula C26H26F3IN2O4 and a molecular weight of 614.40 g/mol. Its IUPAC name is 2-iodo-1-[[4-[2-[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]piperidine-2-carboxylic acid.
| Compound Name | 2-iodo-1-[[4-[2-[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 69198745 |
| Molecular Formula | C26H26F3IN2O4 |
| Molecular Weight | 614.40 g/mol |
| Exact Mass | 614.09 |
| IUPAC Name | 2-iodo-1-[[4-[2-[5-methyl-2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-4-yl]ethoxy]phenyl]methyl]piperidine-2-carboxylic acid |
| SMILES | Cc1oc(-c2ccc(C(F)(F)F)cc2)nc1CCOc1ccc(CN2CCCCC2(I)C(=O)O)cc1 |
| InChI | InChI=1S/C26H26F3IN2O4/c1-17-22(31-23(36-17)19-6-8-20(9-7-19)26(27,28)29)12-15-35-21-10-4-18(5-11-21)16-32-14-3-2-13-25(32,30)24(33)34/h4-11H,2-3,12-16H2,1H3,(H,33,34) |
| InChIKey | ROQBMTCIFKYDHZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.40 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|