C22H21IN2O4 — CID 69172332
2-iodo-1-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methyl]azetidine-2-carboxylic acid (PubChem CID 69172332) has the molecular formula C22H21IN2O4 and a molecular weight of 504.32 g/mol. Its IUPAC name is 2-iodo-1-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methyl]azetidine-2-carboxylic acid.
| Compound Name | 2-iodo-1-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methyl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 69172332 |
| Molecular Formula | C22H21IN2O4 |
| Molecular Weight | 504.32 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | 2-iodo-1-[[4-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methoxy]phenyl]methyl]azetidine-2-carboxylic acid |
| SMILES | Cc1oc(-c2ccccc2)nc1COc1ccc(CN2CCC2(I)C(=O)O)cc1 |
| InChI | InChI=1S/C22H21IN2O4/c1-15-19(24-20(29-15)17-5-3-2-4-6-17)14-28-18-9-7-16(8-10-18)13-25-12-11-22(25,23)21(26)27/h2-10H,11-14H2,1H3,(H,26,27) |
| InChIKey | OWCMFOSQZLFMCI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.32 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|