C26H29BN2O4 — CID 145482247
CID 145482247 (PubChem CID 145482247) has the molecular formula C26H29BN2O4 and a molecular weight of 444.34 g/mol.
| Compound Name | CID 145482247 |
|---|---|
| PubChem CID | 145482247 |
| Molecular Formula | C26H29BN2O4 |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | — |
| SMILES | [B]C1(C(=O)OCC)CCCN(Cc2ccc(OCc3nc(-c4ccccc4)oc3C)cc2)C1 |
| InChI | InChI=1S/C26H29BN2O4/c1-3-31-25(30)26(27)14-7-15-29(18-26)16-20-10-12-22(13-11-20)32-17-23-19(2)33-24(28-23)21-8-5-4-6-9-21/h4-6,8-13H,3,7,14-18H2,1-2H3 |
| InChIKey | JLWLKHDKCSYDMM-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|