C8H13F3N2O — CID 69199406
3-amino-1,1,1-trifluoro-3-piperidin-4-ylpropan-2-one (PubChem CID 69199406) has the molecular formula C8H13F3N2O and a molecular weight of 210.20 g/mol. Its IUPAC name is 3-amino-1,1,1-trifluoro-3-piperidin-4-ylpropan-2-one.
| Compound Name | 3-amino-1,1,1-trifluoro-3-piperidin-4-ylpropan-2-one |
|---|---|
| PubChem CID | 69199406 |
| Molecular Formula | C8H13F3N2O |
| Molecular Weight | 210.20 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-amino-1,1,1-trifluoro-3-piperidin-4-ylpropan-2-one |
| SMILES | NC(C(=O)C(F)(F)F)C1CCNCC1 |
| InChI | InChI=1S/C8H13F3N2O/c9-8(10,11)7(14)6(12)5-1-3-13-4-2-5/h5-6,13H,1-4,12H2 |
| InChIKey | DTTVBUBNOUVMLO-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |