C12H20N2 — CID 69199631
1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine (PubChem CID 69199631) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine.
| Compound Name | 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine |
|---|---|
| PubChem CID | 69199631 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine |
| SMILES | CCC1(N2CCNCC2)C=CC=CC1 |
| InChI | InChI=1S/C12H20N2/c1-2-12(6-4-3-5-7-12)14-10-8-13-9-11-14/h3-6,13H,2,7-11H2,1H3 |
| InChIKey | RYCBUZYMLFFLQO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |