About 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine
1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine (PubChem CID 69199631) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine.
Molecular Properties
| Compound Name | 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine |
| PubChem CID | 69199631 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine |
| SMILES | CCC1(N2CCNCC2)C=CC=CC1 |
| InChI | InChI=1S/C12H20N2/c1-2-12(6-4-3-5-7-12)14-10-8-13-9-11-14/h3-6,13H,2,7-11H2,1H3 |
| InChIKey | RYCBUZYMLFFLQO-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine?
The IUPAC name of 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine (CID 69199631) is 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine.
What is the SMILES notation for 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine?
The canonical SMILES for 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine is CCC1(N2CCNCC2)C=CC=CC1.
What is the InChIKey of 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine?
The InChIKey is RYCBUZYMLFFLQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-2-12(6-4-3-5-7-12)14-10-8-13-9-11-14/h3-6,13H,2,7-11H2,1H3.
What are the key properties of 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine?
1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine has a molecular weight of 192.31 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-ethylcyclohexa-2,4-dien-1-yl)piperazine is sourced from PubChem (CID 69199631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).