C15H17LiNO4 — CID 69200440
CID 69200440 (PubChem CID 69200440) has the molecular formula C15H17LiNO4 and a molecular weight of 282.25 g/mol.
| Compound Name | CID 69200440 |
|---|---|
| PubChem CID | 69200440 |
| Molecular Formula | C15H17LiNO4 |
| Molecular Weight | 282.25 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | — |
| SMILES | CCOc1cc2c(C(C)C(=O)O)cncc2cc1OC.[Li] |
| InChI | InChI=1S/C15H17NO4.Li/c1-4-20-14-6-11-10(5-13(14)19-3)7-16-8-12(11)9(2)15(17)18;/h5-9H,4H2,1-3H3,(H,17,18); |
| InChIKey | HFFPTKVBWSSBHA-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |