C24H23FO4 — CID 69201826
(4-fluoro-2-phenylmethoxyphenyl)-[4-[(3R)-oxolan-3-yl]oxyphenyl]methanol (PubChem CID 69201826) has the molecular formula C24H23FO4 and a molecular weight of 394.44 g/mol. Its IUPAC name is (4-fluoro-2-phenylmethoxyphenyl)-[4-[(3R)-oxolan-3-yl]oxyphenyl]methanol.
| Compound Name | (4-fluoro-2-phenylmethoxyphenyl)-[4-[(3R)-oxolan-3-yl]oxyphenyl]methanol |
|---|---|
| PubChem CID | 69201826 |
| Molecular Formula | C24H23FO4 |
| Molecular Weight | 394.44 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (4-fluoro-2-phenylmethoxyphenyl)-[4-[(3R)-oxolan-3-yl]oxyphenyl]methanol |
| SMILES | OC(c1ccc(O[C@@H]2CCOC2)cc1)c1ccc(F)cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H23FO4/c25-19-8-11-22(23(14-19)28-15-17-4-2-1-3-5-17)24(26)18-6-9-20(10-7-18)29-21-12-13-27-16-21/h1-11,14,21,24,26H,12-13,15-16H2/t21-,24?/m1/s1 |
| InChIKey | NJTDLHBBWIVSJQ-CILPGNKCSA-N |
| XLogP | 4.65 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.44 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |