C27H32N4S — CID 69201976
3-(5-hept-1-ynylthiophen-3-yl)-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole (PubChem CID 69201976) has the molecular formula C27H32N4S and a molecular weight of 444.65 g/mol. Its IUPAC name is 3-(5-hept-1-ynylthiophen-3-yl)-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole.
| Compound Name | 3-(5-hept-1-ynylthiophen-3-yl)-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole |
|---|---|
| PubChem CID | 69201976 |
| Molecular Formula | C27H32N4S |
| Molecular Weight | 444.65 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 3-(5-hept-1-ynylthiophen-3-yl)-6-[(4-methylpiperazin-1-yl)methyl]-1,4-dihydroindeno[2,1-d]pyrazole |
| SMILES | CCCCCC#Cc1cc(-c2n[nH]c3c2Cc2cc(CN4CCN(C)CC4)ccc2-3)cs1 |
| InChI | InChI=1S/C27H32N4S/c1-3-4-5-6-7-8-23-16-22(19-32-23)26-25-17-21-15-20(9-10-24(21)27(25)29-28-26)18-31-13-11-30(2)12-14-31/h9-10,15-16,19H,3-6,11-14,17-18H2,1-2H3,(H,28,29) |
| InChIKey | QQFCSZGIJHCHGH-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.65 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|