C11H10F2O3 — CID 69202251
5-(difluoromethoxy)-6-methoxy-2,3-dihydroinden-1-one (PubChem CID 69202251) has the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. Its IUPAC name is 5-(difluoromethoxy)-6-methoxy-2,3-dihydroinden-1-one.
| Compound Name | 5-(difluoromethoxy)-6-methoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 69202251 |
| Molecular Formula | C11H10F2O3 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 5-(difluoromethoxy)-6-methoxy-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(cc1OC(F)F)CCC2=O |
| InChI | InChI=1S/C11H10F2O3/c1-15-9-5-7-6(2-3-8(7)14)4-10(9)16-11(12)13/h4-5,11H,2-3H2,1H3 |
| InChIKey | JKRPCIZFUUSDKD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |