C24H27N3 — CID 69202900
2-methyl-5,6-bis(4-methylphenyl)-3-piperidin-2-ylpyrazine (PubChem CID 69202900) has the molecular formula C24H27N3 and a molecular weight of 357.50 g/mol. Its IUPAC name is 2-methyl-5,6-bis(4-methylphenyl)-3-piperidin-2-ylpyrazine.
| Compound Name | 2-methyl-5,6-bis(4-methylphenyl)-3-piperidin-2-ylpyrazine |
|---|---|
| PubChem CID | 69202900 |
| Molecular Formula | C24H27N3 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | 2-methyl-5,6-bis(4-methylphenyl)-3-piperidin-2-ylpyrazine |
| SMILES | Cc1ccc(-c2nc(C)c(C3CCCCN3)nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H27N3/c1-16-7-11-19(12-8-16)23-24(20-13-9-17(2)10-14-20)27-22(18(3)26-23)21-6-4-5-15-25-21/h7-14,21,25H,4-6,15H2,1-3H3 |
| InChIKey | QMQHLBUUFBAKPR-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |