C17H20FN3 — CID 115069914
2-(4-fluorophenyl)-4,6-dimethyl-5-piperidin-2-ylpyrimidine (PubChem CID 115069914) has the molecular formula C17H20FN3 and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-4,6-dimethyl-5-piperidin-2-ylpyrimidine.
| Compound Name | 2-(4-fluorophenyl)-4,6-dimethyl-5-piperidin-2-ylpyrimidine |
|---|---|
| PubChem CID | 115069914 |
| Molecular Formula | C17H20FN3 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 2-(4-fluorophenyl)-4,6-dimethyl-5-piperidin-2-ylpyrimidine |
| SMILES | Cc1nc(-c2ccc(F)cc2)nc(C)c1C1CCCCN1 |
| InChI | InChI=1S/C17H20FN3/c1-11-16(15-5-3-4-10-19-15)12(2)21-17(20-11)13-6-8-14(18)9-7-13/h6-9,15,19H,3-5,10H2,1-2H3 |
| InChIKey | XRYWPHBZISKQOE-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |