C15H13N2O3S- — CID 6920398
2-[[3-(pyridin-2-ylsulfanylmethyl)benzoyl]amino]acetate (PubChem CID 6920398) has the molecular formula C15H13N2O3S- and a molecular weight of 301.35 g/mol. Its IUPAC name is 2-[[3-(pyridin-2-ylsulfanylmethyl)benzoyl]amino]acetate.
| Compound Name | 2-[[3-(pyridin-2-ylsulfanylmethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 6920398 |
| Molecular Formula | C15H13N2O3S- |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 2-[[3-(pyridin-2-ylsulfanylmethyl)benzoyl]amino]acetate |
| SMILES | O=C([O-])CNC(=O)c1cccc(CSc2ccccn2)c1 |
| InChI | InChI=1S/C15H14N2O3S/c18-14(19)9-17-15(20)12-5-3-4-11(8-12)10-21-13-6-1-2-7-16-13/h1-8H,9-10H2,(H,17,20)(H,18,19)/p-1 |
| InChIKey | LNHPTGUYBHNLRG-UHFFFAOYSA-M |
| XLogP | 0.85 |
| TPSA | 82.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |