C21H26ClNO — CID 69207908
4-(2-chlorophenyl)-2-(4,4-dimethylhexan-2-yl)benzamide (PubChem CID 69207908) has the molecular formula C21H26ClNO and a molecular weight of 343.90 g/mol. Its IUPAC name is 4-(2-chlorophenyl)-2-(4,4-dimethylhexan-2-yl)benzamide.
| Compound Name | 4-(2-chlorophenyl)-2-(4,4-dimethylhexan-2-yl)benzamide |
|---|---|
| PubChem CID | 69207908 |
| Molecular Formula | C21H26ClNO |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | 4-(2-chlorophenyl)-2-(4,4-dimethylhexan-2-yl)benzamide |
| SMILES | CCC(C)(C)CC(C)c1cc(-c2ccccc2Cl)ccc1C(N)=O |
| InChI | InChI=1S/C21H26ClNO/c1-5-21(3,4)13-14(2)18-12-15(10-11-17(18)20(23)24)16-8-6-7-9-19(16)22/h6-12,14H,5,13H2,1-4H3,(H2,23,24) |
| InChIKey | DKTUPJACZOWVHD-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |