About 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide
2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide (PubChem CID 67855049) has the molecular formula C21H25ClN2O4S
and a molecular weight of 436.96 g/mol. Its IUPAC name is 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide |
| PubChem CID | 67855049 |
| Molecular Formula | C21H25ClN2O4S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide |
| SMILES | CC(=O)NC(C)(C(=O)NS(=O)(=O)c1ccc(-c2ccccc2Cl)cc1C)C(C)C |
| InChI | InChI=1S/C21H25ClN2O4S/c1-13(2)21(5,23-15(4)25)20(26)24-29(27,28)19-11-10-16(12-14(19)3)17-8-6-7-9-18(17)22/h6-13H,1-5H3,(H,23,25)(H,24,26) |
| InChIKey | JBRILAFHHBUNML-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide?
The IUPAC name of 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide (CID 67855049) is 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide.
What is the SMILES notation for 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide?
The canonical SMILES for 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide is CC(=O)NC(C)(C(=O)NS(=O)(=O)c1ccc(-c2ccccc2Cl)cc1C)C(C)C.
What is the InChIKey of 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide?
The InChIKey is JBRILAFHHBUNML-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25ClN2O4S/c1-13(2)21(5,23-15(4)25)20(26)24-29(27,28)19-11-10-16(12-14(19)3)17-8-6-7-9-18(17)22/h6-13H,1-5H3,(H,23,25)(H,24,26).
What are the key properties of 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide?
2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide has a molecular weight of 436.96 g/mol, XLogP of 3.67, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-N-[4-(2-chlorophenyl)-2-methylphenyl]sulfonyl-2,3-dimethylbutanamide is sourced from PubChem (CID 67855049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).