C31H38Cl2N8O3 — CID 69210851
1-acetamido-3-[2-(2-acetylhydrazinyl)-3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-2-[(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]guanidine (PubChem CID 69210851) has the molecular formula C31H38Cl2N8O3 and a molecular weight of 641.60 g/mol. Its IUPAC name is 1-acetamido-3-[2-(2-acetylhydrazinyl)-3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-2-[(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]guanidine.
| Compound Name | 1-acetamido-3-[2-(2-acetylhydrazinyl)-3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-2-[(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]guanidine |
|---|---|
| PubChem CID | 69210851 |
| Molecular Formula | C31H38Cl2N8O3 |
| Molecular Weight | 641.60 g/mol |
| Exact Mass | 640.24 |
| IUPAC Name | 1-acetamido-3-[2-(2-acetylhydrazinyl)-3-[2-(2,4-dichlorophenyl)ethyl]-4-oxoquinazolin-7-yl]-2-[(1R,2R,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]guanidine |
| SMILES | CC(=O)NN/C(=N\[C@H]1C[C@H]2C[C@H]([C@H]1C)C2(C)C)Nc1ccc2c(=O)n(CCc3ccc(Cl)cc3Cl)c(NNC(C)=O)nc2c1 |
| InChI | InChI=1S/C31H38Cl2N8O3/c1-16-24-12-20(31(24,4)5)13-26(16)35-29(39-37-17(2)42)34-22-8-9-23-27(15-22)36-30(40-38-18(3)43)41(28(23)44)11-10-19-6-7-21(32)14-25(19)33/h6-9,14-16,20,24,26H,10-13H2,1-5H3,(H,36,40)(H,37,42)(H,38,43)(H2,34,35,39)/t16-,20-,24-,26+/m1/s1 |
| InChIKey | FTXIVNPXFCGVNA-AHVMUBCASA-N |
| XLogP | 4.89 |
| TPSA | 141.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|