C27H30F3N5O8 — CID 69212304
tert-butyl N-[2-[[2-[[(3R)-1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]carbamoyl]-4-(trifluoromethyl)phenyl]carbamate (PubChem CID 69212304) has the molecular formula C27H30F3N5O8 and a molecular weight of 609.56 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[[(3R)-1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]carbamoyl]-4-(trifluoromethyl)phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[[(3R)-1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]carbamoyl]-4-(trifluoromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 69212304 |
| Molecular Formula | C27H30F3N5O8 |
| Molecular Weight | 609.56 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | tert-butyl N-[2-[[2-[[(3R)-1-[(6-nitro-1,3-benzodioxol-5-yl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]carbamoyl]-4-(trifluoromethyl)phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(C(F)(F)F)cc1C(=O)NCC(=O)N[C@@H]1CCN(Cc2cc3c(cc2[N+](=O)[O-])OCO3)C1 |
| InChI | InChI=1S/C27H30F3N5O8/c1-26(2,3)43-25(38)33-19-5-4-16(27(28,29)30)9-18(19)24(37)31-11-23(36)32-17-6-7-34(13-17)12-15-8-21-22(42-14-41-21)10-20(15)35(39)40/h4-5,8-10,17H,6-7,11-14H2,1-3H3,(H,31,37)(H,32,36)(H,33,38)/t17-/m1/s1 |
| InChIKey | LFQCJLDTGCWIIH-QGZVFWFLSA-N |
| XLogP | 3.81 |
| TPSA | 161.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|