C26H33F3N6O3 — CID 54546715
N-[2-[[(3R)-1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-2-(ethylcarbamoylamino)-5-(trifluoromethyl)benzamide (PubChem CID 54546715) has the molecular formula C26H33F3N6O3 and a molecular weight of 534.58 g/mol. Its IUPAC name is N-[2-[[(3R)-1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-2-(ethylcarbamoylamino)-5-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(3R)-1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-2-(ethylcarbamoylamino)-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 54546715 |
| Molecular Formula | C26H33F3N6O3 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | N-[2-[[(3R)-1-[[4-(dimethylamino)phenyl]methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-2-(ethylcarbamoylamino)-5-(trifluoromethyl)benzamide |
| SMILES | CCNC(=O)Nc1ccc(C(F)(F)F)cc1C(=O)NCC(=O)N[C@@H]1CCN(Cc2ccc(N(C)C)cc2)C1 |
| InChI | InChI=1S/C26H33F3N6O3/c1-4-30-25(38)33-22-10-7-18(26(27,28)29)13-21(22)24(37)31-14-23(36)32-19-11-12-35(16-19)15-17-5-8-20(9-6-17)34(2)3/h5-10,13,19H,4,11-12,14-16H2,1-3H3,(H,31,37)(H,32,36)(H2,30,33,38)/t19-/m1/s1 |
| InChIKey | ZHAIGXGRWPGLQZ-LJQANCHMSA-N |
| XLogP | 3.03 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|