C26H23ClF3NO3 — CID 69212718
3-[3-chloro-4-[(1R)-1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]prop-2-enoic acid (PubChem CID 69212718) has the molecular formula C26H23ClF3NO3 and a molecular weight of 489.92 g/mol. Its IUPAC name is 3-[3-chloro-4-[(1R)-1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-chloro-4-[(1R)-1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 69212718 |
| Molecular Formula | C26H23ClF3NO3 |
| Molecular Weight | 489.92 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | 3-[3-chloro-4-[(1R)-1-[6-[4-(trifluoromethyl)phenyl]-2-pyridinyl]pentoxy]phenyl]prop-2-enoic acid |
| SMILES | CCCC[C@@H](Oc1ccc(C=CC(=O)O)cc1Cl)c1cccc(-c2ccc(C(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C26H23ClF3NO3/c1-2-3-7-24(34-23-14-8-17(16-20(23)27)9-15-25(32)33)22-6-4-5-21(31-22)18-10-12-19(13-11-18)26(28,29)30/h4-6,8-16,24H,2-3,7H2,1H3,(H,32,33)/t24-/m1/s1 |
| InChIKey | DREAEPVIFYDOTJ-XMMPIXPASA-N |
| XLogP | 7.83 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.92 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|