C27H29NO4 — CID 90968659
[4-[1-[6-(4-acetylphenyl)-2-pyridinyl]pentoxy]-2-methylphenyl] acetate (PubChem CID 90968659) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is [4-[1-[6-(4-acetylphenyl)-2-pyridinyl]pentoxy]-2-methylphenyl] acetate.
| Compound Name | [4-[1-[6-(4-acetylphenyl)-2-pyridinyl]pentoxy]-2-methylphenyl] acetate |
|---|---|
| PubChem CID | 90968659 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | [4-[1-[6-(4-acetylphenyl)-2-pyridinyl]pentoxy]-2-methylphenyl] acetate |
| SMILES | CCCCC(Oc1ccc(OC(C)=O)c(C)c1)c1cccc(-c2ccc(C(C)=O)cc2)n1 |
| InChI | InChI=1S/C27H29NO4/c1-5-6-10-27(32-23-15-16-26(18(2)17-23)31-20(4)30)25-9-7-8-24(28-25)22-13-11-21(12-14-22)19(3)29/h7-9,11-17,27H,5-6,10H2,1-4H3 |
| InChIKey | NZGVLYARAAGVKQ-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|