C29H33NO3 — CID 89319004
3-[2-methyl-4-[1-[6-(4-prop-1-en-2-ylphenyl)-2-pyridinyl]pentoxy]phenoxy]prop-1-en-2-ol (PubChem CID 89319004) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is 3-[2-methyl-4-[1-[6-(4-prop-1-en-2-ylphenyl)-2-pyridinyl]pentoxy]phenoxy]prop-1-en-2-ol.
| Compound Name | 3-[2-methyl-4-[1-[6-(4-prop-1-en-2-ylphenyl)-2-pyridinyl]pentoxy]phenoxy]prop-1-en-2-ol |
|---|---|
| PubChem CID | 89319004 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 3-[2-methyl-4-[1-[6-(4-prop-1-en-2-ylphenyl)-2-pyridinyl]pentoxy]phenoxy]prop-1-en-2-ol |
| SMILES | C=C(O)COc1ccc(OC(CCCC)c2cccc(-c3ccc(C(=C)C)cc3)n2)cc1C |
| InChI | InChI=1S/C29H33NO3/c1-6-7-11-29(33-25-16-17-28(21(4)18-25)32-19-22(5)31)27-10-8-9-26(30-27)24-14-12-23(13-15-24)20(2)3/h8-10,12-18,29,31H,2,5-7,11,19H2,1,3-4H3 |
| InChIKey | RHFREQDKORNQGM-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|