C21H26BrNO3 — CID 91239317
[4-[(1S)-1-(6-bromo-2-pyridinyl)pentoxy]-2-methylphenyl] butanoate (PubChem CID 91239317) has the molecular formula C21H26BrNO3 and a molecular weight of 420.35 g/mol. Its IUPAC name is [4-[(1S)-1-(6-bromo-2-pyridinyl)pentoxy]-2-methylphenyl] butanoate.
| Compound Name | [4-[(1S)-1-(6-bromo-2-pyridinyl)pentoxy]-2-methylphenyl] butanoate |
|---|---|
| PubChem CID | 91239317 |
| Molecular Formula | C21H26BrNO3 |
| Molecular Weight | 420.35 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | [4-[(1S)-1-(6-bromo-2-pyridinyl)pentoxy]-2-methylphenyl] butanoate |
| SMILES | CCCC[C@H](Oc1ccc(OC(=O)CCC)c(C)c1)c1cccc(Br)n1 |
| InChI | InChI=1S/C21H26BrNO3/c1-4-6-10-19(17-9-7-11-20(22)23-17)25-16-12-13-18(15(3)14-16)26-21(24)8-5-2/h7,9,11-14,19H,4-6,8,10H2,1-3H3/t19-/m0/s1 |
| InChIKey | DSXHYMPJGBYLNF-IBGZPJMESA-N |
| XLogP | 6.17 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.35 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|