C21H26BrNO5S — CID 142844379
ethyl 2-[4-[1-(6-bromo-2-pyridinyl)-2-propan-2-ylsulfanyloxyethoxy]-2-methylphenoxy]acetate (PubChem CID 142844379) has the molecular formula C21H26BrNO5S and a molecular weight of 484.41 g/mol. Its IUPAC name is ethyl 2-[4-[1-(6-bromo-2-pyridinyl)-2-propan-2-ylsulfanyloxyethoxy]-2-methylphenoxy]acetate.
| Compound Name | ethyl 2-[4-[1-(6-bromo-2-pyridinyl)-2-propan-2-ylsulfanyloxyethoxy]-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 142844379 |
| Molecular Formula | C21H26BrNO5S |
| Molecular Weight | 484.41 g/mol |
| Exact Mass | 483.07 |
| IUPAC Name | ethyl 2-[4-[1-(6-bromo-2-pyridinyl)-2-propan-2-ylsulfanyloxyethoxy]-2-methylphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(OC(COSC(C)C)c2cccc(Br)n2)cc1C |
| InChI | InChI=1S/C21H26BrNO5S/c1-5-25-21(24)13-26-18-10-9-16(11-15(18)4)28-19(12-27-29-14(2)3)17-7-6-8-20(22)23-17/h6-11,14,19H,5,12-13H2,1-4H3 |
| InChIKey | MLOOWWYIXLCATC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.41 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|