C17H16Br2O3S — CID 86633517
ethyl 2-[4-(3,5-dibromophenyl)sulfanyl-2-methylphenoxy]acetate (PubChem CID 86633517) has the molecular formula C17H16Br2O3S and a molecular weight of 460.19 g/mol. Its IUPAC name is ethyl 2-[4-(3,5-dibromophenyl)sulfanyl-2-methylphenoxy]acetate.
| Compound Name | ethyl 2-[4-(3,5-dibromophenyl)sulfanyl-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 86633517 |
| Molecular Formula | C17H16Br2O3S |
| Molecular Weight | 460.19 g/mol |
| Exact Mass | 457.92 |
| IUPAC Name | ethyl 2-[4-(3,5-dibromophenyl)sulfanyl-2-methylphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(Sc2cc(Br)cc(Br)c2)cc1C |
| InChI | InChI=1S/C17H16Br2O3S/c1-3-21-17(20)10-22-16-5-4-14(6-11(16)2)23-15-8-12(18)7-13(19)9-15/h4-9H,3,10H2,1-2H3 |
| InChIKey | SZGLZSWTCLHALC-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.19 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |