C28H27BrO3S — CID 66987215
ethyl 2-[4-[(2E)-2-(6-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)ethyl]sulfanyl-2-methylphenoxy]acetate (PubChem CID 66987215) has the molecular formula C28H27BrO3S and a molecular weight of 523.49 g/mol. Its IUPAC name is ethyl 2-[4-[(2E)-2-(6-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)ethyl]sulfanyl-2-methylphenoxy]acetate.
| Compound Name | ethyl 2-[4-[(2E)-2-(6-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)ethyl]sulfanyl-2-methylphenoxy]acetate |
|---|---|
| PubChem CID | 66987215 |
| Molecular Formula | C28H27BrO3S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | ethyl 2-[4-[(2E)-2-(6-bromo-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene)ethyl]sulfanyl-2-methylphenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(SC/C=C2\c3ccccc3CCc3cc(Br)ccc32)cc1C |
| InChI | InChI=1S/C28H27BrO3S/c1-3-31-28(30)18-32-27-13-11-23(16-19(27)2)33-15-14-26-24-7-5-4-6-20(24)8-9-21-17-22(29)10-12-25(21)26/h4-7,10-14,16-17H,3,8-9,15,18H2,1-2H3/b26-14+ |
| InChIKey | HDOOGEVCDAEEMV-VULFUBBASA-N |
| XLogP | 7.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|