C22H29NO4 — CID 69214676
1-(2-cycloheptyl-2-oxoethylidene)-6-methoxy-3,3-dimethyl-2,4-dihydroisoquinoline-7-carboxylic acid (PubChem CID 69214676) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is 1-(2-cycloheptyl-2-oxoethylidene)-6-methoxy-3,3-dimethyl-2,4-dihydroisoquinoline-7-carboxylic acid.
| Compound Name | 1-(2-cycloheptyl-2-oxoethylidene)-6-methoxy-3,3-dimethyl-2,4-dihydroisoquinoline-7-carboxylic acid |
|---|---|
| PubChem CID | 69214676 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 1-(2-cycloheptyl-2-oxoethylidene)-6-methoxy-3,3-dimethyl-2,4-dihydroisoquinoline-7-carboxylic acid |
| SMILES | COc1cc2c(cc1C(=O)O)C(=CC(=O)C1CCCCCC1)NC(C)(C)C2 |
| InChI | InChI=1S/C22H29NO4/c1-22(2)13-15-10-20(27-3)17(21(25)26)11-16(15)18(23-22)12-19(24)14-8-6-4-5-7-9-14/h10-12,14,23H,4-9,13H2,1-3H3,(H,25,26) |
| InChIKey | CEXDPDULPDFGJB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|