C12H11O4- — CID 6921490
3-(5-methoxy-1-benzofuran-3-yl)propanoate (PubChem CID 6921490) has the molecular formula C12H11O4- and a molecular weight of 219.22 g/mol. Its IUPAC name is 3-(5-methoxy-1-benzofuran-3-yl)propanoate.
| Compound Name | 3-(5-methoxy-1-benzofuran-3-yl)propanoate |
|---|---|
| PubChem CID | 6921490 |
| Molecular Formula | C12H11O4- |
| Molecular Weight | 219.22 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 3-(5-methoxy-1-benzofuran-3-yl)propanoate |
| SMILES | COc1ccc2occ(CCC(=O)[O-])c2c1 |
| InChI | InChI=1S/C12H12O4/c1-15-9-3-4-11-10(6-9)8(7-16-11)2-5-12(13)14/h3-4,6-7H,2,5H2,1H3,(H,13,14)/p-1 |
| InChIKey | VZPMUJFKNXHPCE-UHFFFAOYSA-M |
| XLogP | 1.12 |
| TPSA | 62.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |