C19H22O6S — CID 86752741
3-(5-methoxy-1-benzofuran-3-yl)propan-1-ol;4-methylbenzenesulfonic acid (PubChem CID 86752741) has the molecular formula C19H22O6S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3-(5-methoxy-1-benzofuran-3-yl)propan-1-ol;4-methylbenzenesulfonic acid.
| Compound Name | 3-(5-methoxy-1-benzofuran-3-yl)propan-1-ol;4-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 86752741 |
| Molecular Formula | C19H22O6S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 3-(5-methoxy-1-benzofuran-3-yl)propan-1-ol;4-methylbenzenesulfonic acid |
| SMILES | COc1ccc2occ(CCCO)c2c1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C12H14O3.C7H8O3S/c1-14-10-4-5-12-11(7-10)9(8-15-12)3-2-6-13;1-6-2-4-7(5-3-6)11(8,9)10/h4-5,7-8,13H,2-3,6H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | FLACCJQPKQJSOC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|