C20H22O5S — CID 71444206
4-methylbenzenesulfonic acid;3-naphthalen-2-yloxypropan-1-ol (PubChem CID 71444206) has the molecular formula C20H22O5S and a molecular weight of 374.46 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;3-naphthalen-2-yloxypropan-1-ol.
| Compound Name | 4-methylbenzenesulfonic acid;3-naphthalen-2-yloxypropan-1-ol |
|---|---|
| PubChem CID | 71444206 |
| Molecular Formula | C20H22O5S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 4-methylbenzenesulfonic acid;3-naphthalen-2-yloxypropan-1-ol |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.OCCCOc1ccc2ccccc2c1 |
| InChI | InChI=1S/C13H14O2.C7H8O3S/c14-8-3-9-15-13-7-6-11-4-1-2-5-12(11)10-13;1-6-2-4-7(5-3-6)11(8,9)10/h1-2,4-7,10,14H,3,8-9H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | GZFOHJOGMHPXHQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|