C25H23Cl2F3N4O4 — CID 69216268
N-[(6S,7aR)-2-(3,5-dichlorophenyl)-1,3-dioxo-7a-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-6-yl]pyrrolidine-1-carboxamide (PubChem CID 69216268) has the molecular formula C25H23Cl2F3N4O4 and a molecular weight of 571.38 g/mol. Its IUPAC name is N-[(6S,7aR)-2-(3,5-dichlorophenyl)-1,3-dioxo-7a-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-6-yl]pyrrolidine-1-carboxamide.
| Compound Name | N-[(6S,7aR)-2-(3,5-dichlorophenyl)-1,3-dioxo-7a-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-6-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 69216268 |
| Molecular Formula | C25H23Cl2F3N4O4 |
| Molecular Weight | 571.38 g/mol |
| Exact Mass | 570.10 |
| IUPAC Name | N-[(6S,7aR)-2-(3,5-dichlorophenyl)-1,3-dioxo-7a-[[4-(trifluoromethoxy)phenyl]methyl]-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-6-yl]pyrrolidine-1-carboxamide |
| SMILES | O=C(N[C@@H]1CN2C(=O)N(c3cc(Cl)cc(Cl)c3)C(=O)[C@@]2(Cc2ccc(OC(F)(F)F)cc2)C1)N1CCCC1 |
| InChI | InChI=1S/C25H23Cl2F3N4O4/c26-16-9-17(27)11-19(10-16)34-21(35)24(12-15-3-5-20(6-4-15)38-25(28,29)30)13-18(14-33(24)23(34)37)31-22(36)32-7-1-2-8-32/h3-6,9-11,18H,1-2,7-8,12-14H2,(H,31,36)/t18-,24+/m0/s1 |
| InChIKey | JMEMIXZUZANJKI-MHECFPHRSA-N |
| XLogP | 5.22 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.38 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|