C18H23ClN2+2 — CID 6921741
1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-methylpiperazine-1,4-diium (PubChem CID 6921741) has the molecular formula C18H23ClN2+2 and a molecular weight of 302.85 g/mol. Its IUPAC name is 1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-methylpiperazine-1,4-diium.
| Compound Name | 1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-methylpiperazine-1,4-diium |
|---|---|
| PubChem CID | 6921741 |
| Molecular Formula | C18H23ClN2+2 |
| Molecular Weight | 302.85 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 1-[(S)-(4-chlorophenyl)-phenylmethyl]-4-methylpiperazine-1,4-diium |
| SMILES | C[NH+]1CC[NH+]([C@@H](c2ccccc2)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C18H21ClN2/c1-20-11-13-21(14-12-20)18(15-5-3-2-4-6-15)16-7-9-17(19)10-8-16/h2-10,18H,11-14H2,1H3/p+2/t18-/m0/s1 |
| InChIKey | WFNAKBGANONZEQ-SFHVURJKSA-P |
| XLogP | 0.84 |
| TPSA | 8.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.85 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |