C33H35N5O3 — CID 69219991
N-(3-anilinopropyl)-N-[1-(5-benzyl-3-methyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-6-yl)propyl]-4-methylbenzamide (PubChem CID 69219991) has the molecular formula C33H35N5O3 and a molecular weight of 549.68 g/mol. Its IUPAC name is N-(3-anilinopropyl)-N-[1-(5-benzyl-3-methyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-6-yl)propyl]-4-methylbenzamide.
| Compound Name | N-(3-anilinopropyl)-N-[1-(5-benzyl-3-methyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-6-yl)propyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 69219991 |
| Molecular Formula | C33H35N5O3 |
| Molecular Weight | 549.68 g/mol |
| Exact Mass | 549.27 |
| IUPAC Name | N-(3-anilinopropyl)-N-[1-(5-benzyl-3-methyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-6-yl)propyl]-4-methylbenzamide |
| SMILES | CCC(c1nc2onc(C)c2c(=O)n1Cc1ccccc1)N(CCCNc1ccccc1)C(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C33H35N5O3/c1-4-28(30-35-31-29(24(3)36-41-31)33(40)38(30)22-25-12-7-5-8-13-25)37(32(39)26-18-16-23(2)17-19-26)21-11-20-34-27-14-9-6-10-15-27/h5-10,12-19,28,34H,4,11,20-22H2,1-3H3 |
| InChIKey | YBFRLHGHPZHXSO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.68 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|