C25H23FN2O3 — CID 69221455
(3R)-1-benzyl-3-ethyl-7-fluoro-4-(3-methoxybenzoyl)-3H-quinoxalin-2-one (PubChem CID 69221455) has the molecular formula C25H23FN2O3 and a molecular weight of 418.47 g/mol. Its IUPAC name is (3R)-1-benzyl-3-ethyl-7-fluoro-4-(3-methoxybenzoyl)-3H-quinoxalin-2-one.
| Compound Name | (3R)-1-benzyl-3-ethyl-7-fluoro-4-(3-methoxybenzoyl)-3H-quinoxalin-2-one |
|---|---|
| PubChem CID | 69221455 |
| Molecular Formula | C25H23FN2O3 |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | (3R)-1-benzyl-3-ethyl-7-fluoro-4-(3-methoxybenzoyl)-3H-quinoxalin-2-one |
| SMILES | CC[C@@H]1C(=O)N(Cc2ccccc2)c2cc(F)ccc2N1C(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C25H23FN2O3/c1-3-21-25(30)27(16-17-8-5-4-6-9-17)23-15-19(26)12-13-22(23)28(21)24(29)18-10-7-11-20(14-18)31-2/h4-15,21H,3,16H2,1-2H3/t21-/m1/s1 |
| InChIKey | HHXXMOGJBIYJKH-OAQYLSRUSA-N |
| XLogP | 4.81 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |