C20H21FN2O3 — CID 69223676
(3R)-1,3-diethyl-6-fluoro-4-(3-methoxybenzoyl)-3H-quinoxalin-2-one (PubChem CID 69223676) has the molecular formula C20H21FN2O3 and a molecular weight of 356.40 g/mol. Its IUPAC name is (3R)-1,3-diethyl-6-fluoro-4-(3-methoxybenzoyl)-3H-quinoxalin-2-one.
| Compound Name | (3R)-1,3-diethyl-6-fluoro-4-(3-methoxybenzoyl)-3H-quinoxalin-2-one |
|---|---|
| PubChem CID | 69223676 |
| Molecular Formula | C20H21FN2O3 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (3R)-1,3-diethyl-6-fluoro-4-(3-methoxybenzoyl)-3H-quinoxalin-2-one |
| SMILES | CC[C@@H]1C(=O)N(CC)c2ccc(F)cc2N1C(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H21FN2O3/c1-4-16-20(25)22(5-2)17-10-9-14(21)12-18(17)23(16)19(24)13-7-6-8-15(11-13)26-3/h6-12,16H,4-5H2,1-3H3/t16-/m1/s1 |
| InChIKey | AXUNOWKXKDFMOR-MRXNPFEDSA-N |
| XLogP | 3.63 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |