C27H25ClFN3O3 — CID 69221463
N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepine-11-carbonyl)-3-chlorophenyl]-5-fluoro-2-methylbenzamide (PubChem CID 69221463) has the molecular formula C27H25ClFN3O3 and a molecular weight of 493.97 g/mol. Its IUPAC name is N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepine-11-carbonyl)-3-chlorophenyl]-5-fluoro-2-methylbenzamide.
| Compound Name | N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepine-11-carbonyl)-3-chlorophenyl]-5-fluoro-2-methylbenzamide |
|---|---|
| PubChem CID | 69221463 |
| Molecular Formula | C27H25ClFN3O3 |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepine-11-carbonyl)-3-chlorophenyl]-5-fluoro-2-methylbenzamide |
| SMILES | Cc1ccc(F)cc1C(=O)Nc1ccc(C(=O)C2CC=CC3=CNC=C4COCCN4C32)c(Cl)c1 |
| InChI | InChI=1S/C27H25ClFN3O3/c1-16-5-6-18(29)11-23(16)27(34)31-19-7-8-21(24(28)12-19)26(33)22-4-2-3-17-13-30-14-20-15-35-10-9-32(20)25(17)22/h2-3,5-8,11-14,22,25,30H,4,9-10,15H2,1H3,(H,31,34) |
| InChIKey | SYGRGKZZJURBIP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |