C33H31N3O3 — CID 69151407
N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepine-11-carbonyl)-3-methylphenyl]-2-phenylbenzamide (PubChem CID 69151407) has the molecular formula C33H31N3O3 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepine-11-carbonyl)-3-methylphenyl]-2-phenylbenzamide.
| Compound Name | N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepine-11-carbonyl)-3-methylphenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 69151407 |
| Molecular Formula | C33H31N3O3 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | N-[4-(2,4,6,10,11,11a-hexahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepine-11-carbonyl)-3-methylphenyl]-2-phenylbenzamide |
| SMILES | Cc1cc(NC(=O)c2ccccc2-c2ccccc2)ccc1C(=O)C1CC=CC2=CNC=C3COCCN3C21 |
| InChI | InChI=1S/C33H31N3O3/c1-22-18-25(35-33(38)29-12-6-5-11-28(29)23-8-3-2-4-9-23)14-15-27(22)32(37)30-13-7-10-24-19-34-20-26-21-39-17-16-36(26)31(24)30/h2-12,14-15,18-20,30-31,34H,13,16-17,21H2,1H3,(H,35,38) |
| InChIKey | YQHVYXDDNZYVLC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |