C33H29FN3O3+ — CID 91086157
N-[3-fluoro-4-(2,4,6,8-tetrahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepin-12-ium-12-carbonyl)phenyl]-2-(4-methylphenyl)benzamide (PubChem CID 91086157) has the molecular formula C33H29FN3O3+ and a molecular weight of 534.61 g/mol. Its IUPAC name is N-[3-fluoro-4-(2,4,6,8-tetrahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepin-12-ium-12-carbonyl)phenyl]-2-(4-methylphenyl)benzamide.
| Compound Name | N-[3-fluoro-4-(2,4,6,8-tetrahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepin-12-ium-12-carbonyl)phenyl]-2-(4-methylphenyl)benzamide |
|---|---|
| PubChem CID | 91086157 |
| Molecular Formula | C33H29FN3O3+ |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | N-[3-fluoro-4-(2,4,6,8-tetrahydro-1H-[1,4]oxazino[4,3-a][1,4]benzodiazepin-12-ium-12-carbonyl)phenyl]-2-(4-methylphenyl)benzamide |
| SMILES | Cc1ccc(-c2ccccc2C(=O)Nc2ccc(C(=O)[N+]34CCOCC3=CNC=C3CC=CC=C34)c(F)c2)cc1 |
| InChI | InChI=1S/C33H28FN3O3/c1-22-10-12-23(13-11-22)27-7-3-4-8-28(27)32(38)36-25-14-15-29(30(34)18-25)33(39)37-16-17-40-21-26(37)20-35-19-24-6-2-5-9-31(24)37/h2-5,7-15,18-20,35H,6,16-17,21H2,1H3/p+1 |
| InChIKey | XZSHFSRJDKQNDP-UHFFFAOYSA-O |
| XLogP | 6.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|