C33H30N3O2S+ — CID 91804077
N-[3-methyl-4-(2,4,6,8-tetrahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepin-12-ium-12-carbonyl)phenyl]-2-phenylbenzamide (PubChem CID 91804077) has the molecular formula C33H30N3O2S+ and a molecular weight of 532.69 g/mol. Its IUPAC name is N-[3-methyl-4-(2,4,6,8-tetrahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepin-12-ium-12-carbonyl)phenyl]-2-phenylbenzamide.
| Compound Name | N-[3-methyl-4-(2,4,6,8-tetrahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepin-12-ium-12-carbonyl)phenyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 91804077 |
| Molecular Formula | C33H30N3O2S+ |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | N-[3-methyl-4-(2,4,6,8-tetrahydro-1H-[1,4]thiazino[4,3-a][1,4]benzodiazepin-12-ium-12-carbonyl)phenyl]-2-phenylbenzamide |
| SMILES | Cc1cc(NC(=O)c2ccccc2-c2ccccc2)ccc1C(=O)[N+]12CCSCC1=CNC=C1CC=CC=C12 |
| InChI | InChI=1S/C33H29N3O2S/c1-23-19-26(35-32(37)30-13-7-6-12-29(30)24-9-3-2-4-10-24)15-16-28(23)33(38)36-17-18-39-22-27(36)21-34-20-25-11-5-8-14-31(25)36/h2-10,12-16,19-21,34H,11,17-18,22H2,1H3/p+1 |
| InChIKey | UVDIVAMAPRVJJY-UHFFFAOYSA-O |
| XLogP | 6.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|